C23H36N2O2 — CID 5132170
1-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]butan-1-one (PubChem CID 5132170) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]butan-1-one.
| Compound Name | 1-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 5132170 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 1-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCC2(O)CCCCC2C1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H36N2O2/c1-4-9-21(26)25-17-16-23(27)15-8-7-10-20(23)22(25)18-11-13-19(14-12-18)24(5-2)6-3/h11-14,20,22,27H,4-10,15-17H2,1-3H3 |
| InChIKey | FZDFHOXTIXAPMH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|