C25H39N3O2 — CID 40621523
2-[(1S,4aS,8aS)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 40621523) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-[(1S,4aS,8aS)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[(1S,4aS,8aS)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 40621523 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 2-[(1S,4aS,8aS)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | CCN(CC)c1ccc([C@@H]2[C@@H]3CCCC[C@]3(O)CCN2CC(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H39N3O2/c1-3-26(4-2)21-12-10-20(11-13-21)24-22-9-5-6-14-25(22,30)15-18-28(24)19-23(29)27-16-7-8-17-27/h10-13,22,24,30H,3-9,14-19H2,1-2H3/t22-,24+,25-/m0/s1 |
| InChIKey | FJKKGIYVDZUNMO-CAOCKLPOSA-N |
| XLogP | 3.82 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|