C29H41N3O4S — CID 6577680
methyl 2-[[2-[(1R,4aR,8aR)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 6577680) has the molecular formula C29H41N3O4S and a molecular weight of 527.73 g/mol. Its IUPAC name is methyl 2-[[2-[(1R,4aR,8aR)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(1R,4aR,8aR)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6577680 |
| Molecular Formula | C29H41N3O4S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | methyl 2-[[2-[(1R,4aR,8aR)-1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCN(CC)c1ccc([C@H]2[C@H]3CCCC[C@@]3(O)CCN2CC(=O)Nc2sc(C)c(C)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C29H41N3O4S/c1-6-31(7-2)22-13-11-21(12-14-22)26-23-10-8-9-15-29(23,35)16-17-32(26)18-24(33)30-27-25(28(34)36-5)19(3)20(4)37-27/h11-14,23,26,35H,6-10,15-18H2,1-5H3,(H,30,33)/t23-,26+,29-/m1/s1 |
| InChIKey | BGJBHNMVORQADH-ZSOKXDGFSA-N |
| XLogP | 5.30 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|