C22H35N3O2 — CID 3757742
3-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]propanamide (PubChem CID 3757742) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 3-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]propanamide.
| Compound Name | 3-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]propanamide |
|---|---|
| PubChem CID | 3757742 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 3-[1-[4-(diethylamino)phenyl]-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]propanamide |
| SMILES | CCN(CC)c1ccc(C2C3CCCCC3(O)CCN2CCC(N)=O)cc1 |
| InChI | InChI=1S/C22H35N3O2/c1-3-24(4-2)18-10-8-17(9-11-18)21-19-7-5-6-13-22(19,27)14-16-25(21)15-12-20(23)26/h8-11,19,21,27H,3-7,12-16H2,1-2H3,(H2,23,26) |
| InChIKey | GVDKSABGTFTFJI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|