C19H28N2O4 — CID 6569658
2-[(1R,4aR,8aR)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetamide (PubChem CID 6569658) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[(1R,4aR,8aR)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetamide.
| Compound Name | 2-[(1R,4aR,8aR)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 6569658 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[(1R,4aR,8aR)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetamide |
| SMILES | COc1ccc([C@H]2[C@H]3CCCC[C@@]3(O)CCN2CC(N)=O)cc1OC |
| InChI | InChI=1S/C19H28N2O4/c1-24-15-7-6-13(11-16(15)25-2)18-14-5-3-4-8-19(14,23)9-10-21(18)12-17(20)22/h6-7,11,14,18,23H,3-5,8-10,12H2,1-2H3,(H2,20,22)/t14-,18+,19-/m1/s1 |
| InChIKey | NSLZZAZISRNRBN-MDASCCDHSA-N |
| XLogP | 1.86 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |