C23H24N2O3 — CID 98192764
(1S,9R,12Z)-12-[(E)-3-[4-(dimethylamino)phenyl]-1-hydroxyprop-2-enylidene]-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one (PubChem CID 98192764) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1S,9R,12Z)-12-[(E)-3-[4-(dimethylamino)phenyl]-1-hydroxyprop-2-enylidene]-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one.
| Compound Name | (1S,9R,12Z)-12-[(E)-3-[4-(dimethylamino)phenyl]-1-hydroxyprop-2-enylidene]-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 98192764 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (1S,9R,12Z)-12-[(E)-3-[4-(dimethylamino)phenyl]-1-hydroxyprop-2-enylidene]-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
| SMILES | CN(C)c1ccc(/C=C/C(O)=C2/C(=O)N[C@@]3(C)C[C@H]2c2ccccc2O3)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-23-14-18(17-6-4-5-7-20(17)28-23)21(22(27)24-23)19(26)13-10-15-8-11-16(12-9-15)25(2)3/h4-13,18,26H,14H2,1-3H3,(H,24,27)/b13-10+,21-19-/t18-,23+/m0/s1 |
| InChIKey | LWIRVQAYQOXBEA-LLIPNOFHSA-N |
| XLogP | 3.99 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|