C27H25NO — CID 23460816
(E)-3-[4-(dimethylamino)phenyl]-1-(4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)prop-2-en-1-one (PubChem CID 23460816) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is (E)-3-[4-(dimethylamino)phenyl]-1-(4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(dimethylamino)phenyl]-1-(4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 23460816 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (E)-3-[4-(dimethylamino)phenyl]-1-(4-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)prop-2-en-1-one |
| SMILES | CN(C)c1ccc(/C=C/C(=O)c2ccc3c(c2)C2CCC3c3ccccc32)cc1 |
| InChI | InChI=1S/C27H25NO/c1-28(2)20-11-7-18(8-12-20)9-16-27(29)19-10-13-24-23-14-15-25(26(24)17-19)22-6-4-3-5-21(22)23/h3-13,16-17,23,25H,14-15H2,1-2H3/b16-9+ |
| InChIKey | HHPNBRBZHGXNNE-CXUHLZMHSA-N |
| XLogP | 6.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|