C15H17NO3 — CID 98217711
methyl (1S,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate (PubChem CID 98217711) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl (1S,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate.
| Compound Name | methyl (1S,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 98217711 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl (1S,9R)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate |
| SMILES | COC(=O)C1=C(C)N[C@@]2(C)C[C@H]1c1ccccc1O2 |
| InChI | InChI=1S/C15H17NO3/c1-9-13(14(17)18-3)11-8-15(2,16-9)19-12-7-5-4-6-10(11)12/h4-7,11,16H,8H2,1-3H3/t11-,15+/m0/s1 |
| InChIKey | OAGWDCDAJWPANW-XHDPSFHLSA-N |
| XLogP | 2.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |