C21H27NO3 — CID 75539296
cyclohexylmethyl (1R,9S)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate (PubChem CID 75539296) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is cyclohexylmethyl (1R,9S)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate.
| Compound Name | cyclohexylmethyl (1R,9S)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 75539296 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | cyclohexylmethyl (1R,9S)-9,11-dimethyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6,11-tetraene-12-carboxylate |
| SMILES | CC1=C(C(=O)OCC2CCCCC2)[C@@H]2C[C@@](C)(N1)Oc1ccccc12 |
| InChI | InChI=1S/C21H27NO3/c1-14-19(20(23)24-13-15-8-4-3-5-9-15)17-12-21(2,22-14)25-18-11-7-6-10-16(17)18/h6-7,10-11,15,17,22H,3-5,8-9,12-13H2,1-2H3/t17-,21+/m1/s1 |
| InChIKey | ONMLSLZLTMJBPU-UTKZUKDTSA-N |
| XLogP | 4.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |