C22H20N4O7 — CID 100890140
(4'aR,5S)-1-(2-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 100890140) has the molecular formula C22H20N4O7 and a molecular weight of 452.42 g/mol. Its IUPAC name is (4'aR,5S)-1-(2-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aR,5S)-1-(2-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 100890140 |
| Molecular Formula | C22H20N4O7 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (4'aR,5S)-1-(2-methoxyphenyl)-8'-nitrospiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccccc1N1C(=O)NC(=O)[C@@]2(Cc3cc([N+](=O)[O-])ccc3N3CCOC[C@H]32)C1=O |
| InChI | InChI=1S/C22H20N4O7/c1-32-17-5-3-2-4-16(17)25-20(28)22(19(27)23-21(25)29)11-13-10-14(26(30)31)6-7-15(13)24-8-9-33-12-18(22)24/h2-7,10,18H,8-9,11-12H2,1H3,(H,23,27,29)/t18-,22-/m0/s1 |
| InChIKey | BFJHALXEYKVZAA-AVRDEDQJSA-N |
| XLogP | 1.63 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|