C22H30N2O5S — CID 100893737
7-[(2R)-4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-oxobutan-2-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 100893737) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is 7-[(2R)-4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-oxobutan-2-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[(2R)-4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-oxobutan-2-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 100893737 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 7-[(2R)-4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-oxobutan-2-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(cc1S(=O)(=O)[C@H](C)CC(=O)N1CCC[C@H]3CCCC[C@H]31)OCC(=O)N2 |
| InChI | InChI=1S/C22H30N2O5S/c1-14-10-17-19(29-13-21(25)23-17)12-20(14)30(27,28)15(2)11-22(26)24-9-5-7-16-6-3-4-8-18(16)24/h10,12,15-16,18H,3-9,11,13H2,1-2H3,(H,23,25)/t15-,16-,18-/m1/s1 |
| InChIKey | UGDVWLVBZNNDID-JFIYKMOQSA-N |
| XLogP | 3.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |