C16H28N2O3 — CID 100896865
2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-[(3R)-2-methyl-4-oxopentan-3-yl]acetamide (PubChem CID 100896865) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-[(3R)-2-methyl-4-oxopentan-3-yl]acetamide.
| Compound Name | 2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-[(3R)-2-methyl-4-oxopentan-3-yl]acetamide |
|---|---|
| PubChem CID | 100896865 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-N-[(3R)-2-methyl-4-oxopentan-3-yl]acetamide |
| SMILES | CC(=O)[C@H](NC(=O)CN1CCO[C@@H]2CCCC[C@H]21)C(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-11(2)16(12(3)19)17-15(20)10-18-8-9-21-14-7-5-4-6-13(14)18/h11,13-14,16H,4-10H2,1-3H3,(H,17,20)/t13-,14-,16-/m1/s1 |
| InChIKey | VEPWAJGITKDOPW-IIAWOOMASA-N |
| XLogP | 1.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |