C14H13F2N3O4S — CID 10089691
[(2R)-2-(2,4-difluorophenyl)-3-sulfonyl-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate (PubChem CID 10089691) has the molecular formula C14H13F2N3O4S and a molecular weight of 357.34 g/mol. Its IUPAC name is [(2R)-2-(2,4-difluorophenyl)-3-sulfonyl-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate.
| Compound Name | [(2R)-2-(2,4-difluorophenyl)-3-sulfonyl-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate |
|---|---|
| PubChem CID | 10089691 |
| Molecular Formula | C14H13F2N3O4S |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [(2R)-2-(2,4-difluorophenyl)-3-sulfonyl-1-(1,2,4-triazol-1-yl)butan-2-yl] acetate |
| SMILES | CC(=O)O[C@](Cn1cncn1)(C(C)=S(=O)=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2N3O4S/c1-9(24(21)22)14(23-10(2)20,6-19-8-17-7-18-19)12-4-3-11(15)5-13(12)16/h3-5,7-8H,6H2,1-2H3/t14-/m1/s1 |
| InChIKey | JELFTCMJDSRPKE-CQSZACIVSA-N |
| XLogP | 1.09 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|