C20H16N4O5 — CID 100898450
(3aS,4R,7R,7aS)-7-[[(5-nitro-2-pyridinyl)amino]methyl]-2-phenyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 100898450) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is (3aS,4R,7R,7aS)-7-[[(5-nitro-2-pyridinyl)amino]methyl]-2-phenyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7R,7aS)-7-[[(5-nitro-2-pyridinyl)amino]methyl]-2-phenyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 100898450 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (3aS,4R,7R,7aS)-7-[[(5-nitro-2-pyridinyl)amino]methyl]-2-phenyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@](CNc4ccc([N+](=O)[O-])cn4)(O3)[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H16N4O5/c25-18-16-14-8-9-20(29-14,11-22-15-7-6-13(10-21-15)24(27)28)17(16)19(26)23(18)12-4-2-1-3-5-12/h1-10,14,16-17H,11H2,(H,21,22)/t14-,16-,17-,20+/m1/s1 |
| InChIKey | RUTDEKOGNOANKJ-OYRIPWCXSA-N |
| XLogP | 1.91 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|