C22H15Cl2N3O6 — CID 99734309
N-[[(3aS,4R,7S,7aR)-2-(4-nitrophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,4-dichlorobenzamide (PubChem CID 99734309) has the molecular formula C22H15Cl2N3O6 and a molecular weight of 488.28 g/mol. Its IUPAC name is N-[[(3aS,4R,7S,7aR)-2-(4-nitrophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,4-dichlorobenzamide.
| Compound Name | N-[[(3aS,4R,7S,7aR)-2-(4-nitrophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 99734309 |
| Molecular Formula | C22H15Cl2N3O6 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | N-[[(3aS,4R,7S,7aR)-2-(4-nitrophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NC[C@]12C=C[C@H](O1)[C@@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@H]12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H15Cl2N3O6/c23-11-1-6-14(15(24)9-11)19(28)25-10-22-8-7-16(33-22)17-18(22)21(30)26(20(17)29)12-2-4-13(5-3-12)27(31)32/h1-9,16-18H,10H2,(H,25,28)/t16-,17-,18+,22-/m0/s1 |
| InChIKey | KGKISOOXXVBSEF-AYMMHLMVSA-N |
| XLogP | 3.14 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|