C23H17Cl3N2O5 — CID 129413751
N-[[(3aS,4S,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 129413751) has the molecular formula C23H17Cl3N2O5 and a molecular weight of 507.76 g/mol. Its IUPAC name is N-[[(3aS,4S,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[[(3aS,4S,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 129413751 |
| Molecular Formula | C23H17Cl3N2O5 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | N-[[(3aS,4S,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC[C@@]12C=C[C@@H](O1)[C@@H]1C(=O)N(c3ccc(Cl)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C23H17Cl3N2O5/c24-12-1-4-14(5-2-12)28-21(30)19-17-7-8-23(33-17,20(19)22(28)31)11-27-18(29)10-32-16-6-3-13(25)9-15(16)26/h1-9,17,19-20H,10-11H2,(H,27,29)/t17-,19+,20-,23-/m1/s1 |
| InChIKey | BRHFHJUGMLYSHN-RKCFAAOBSA-N |
| XLogP | 3.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|