C24H22N2O5 — CID 1286897
N-[[(3aR,4S,7R,7aS)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-phenoxyacetamide (PubChem CID 1286897) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[[(3aR,4S,7R,7aS)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-phenoxyacetamide.
| Compound Name | N-[[(3aR,4S,7R,7aS)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 1286897 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[[(3aR,4S,7R,7aS)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-phenoxyacetamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@]2(CNC(=O)COc4ccccc4)C=C[C@H]3O2)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-15-7-9-16(10-8-15)26-22(28)20-18-11-12-24(31-18,21(20)23(26)29)14-25-19(27)13-30-17-5-3-2-4-6-17/h2-12,18,20-21H,13-14H2,1H3,(H,25,27)/t18-,20-,21+,24-/m1/s1 |
| InChIKey | FDBIKBUBWRSSSJ-ZGDJDIHISA-N |
| XLogP | 2.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|