C26H27N5O3S — CID 98610004
N-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-4-pyridin-2-ylpiperazine-1-carbothioamide (PubChem CID 98610004) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-4-pyridin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-4-pyridin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 98610004 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-4-pyridin-2-ylpiperazine-1-carbothioamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@H]4C=C[C@@](CNC(=S)N5CCN(c6ccccn6)CC5)(O4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H27N5O3S/c1-17-5-7-18(8-6-17)31-23(32)21-19-9-10-26(34-19,22(21)24(31)33)16-28-25(35)30-14-12-29(13-15-30)20-4-2-3-11-27-20/h2-11,19,21-22H,12-16H2,1H3,(H,28,35)/t19-,21+,22-,26+/m1/s1 |
| InChIKey | OGTKHKVLRCMZLG-MRESPNAKSA-N |
| XLogP | 1.90 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|