C23H17Cl3N2O5 — CID 98118362
(2,4,5-trichlorophenyl)methyl N-[[(3aR,4S,7S,7aR)-1,3-dioxo-2-phenyl-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]carbamate (PubChem CID 98118362) has the molecular formula C23H17Cl3N2O5 and a molecular weight of 507.76 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl)methyl N-[[(3aR,4S,7S,7aR)-1,3-dioxo-2-phenyl-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]carbamate.
| Compound Name | (2,4,5-trichlorophenyl)methyl N-[[(3aR,4S,7S,7aR)-1,3-dioxo-2-phenyl-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 98118362 |
| Molecular Formula | C23H17Cl3N2O5 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | (2,4,5-trichlorophenyl)methyl N-[[(3aR,4S,7S,7aR)-1,3-dioxo-2-phenyl-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]carbamate |
| SMILES | O=C(NC[C@@]12C=C[C@H](O1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12)OCc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl3N2O5/c24-14-9-16(26)15(25)8-12(14)10-32-22(31)27-11-23-7-6-17(33-23)18-19(23)21(30)28(20(18)29)13-4-2-1-3-5-13/h1-9,17-19H,10-11H2,(H,27,31)/t17-,18-,19-,23+/m0/s1 |
| InChIKey | DOORZNORUPKABJ-KEXUJGGDSA-N |
| XLogP | 4.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|