C17H15NO6 — CID 146682031
benzyl N-[[(1S,2S,6R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl]methyl]carbamate (PubChem CID 146682031) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is benzyl N-[[(1S,2S,6R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(1S,2S,6R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 146682031 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | benzyl N-[[(1S,2S,6R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl]methyl]carbamate |
| SMILES | O=C(NC[C@@]12C=CC(O1)[C@@H]1C(=O)OC(=O)[C@@H]12)OCc1ccccc1 |
| InChI | InChI=1S/C17H15NO6/c19-14-12-11-6-7-17(24-11,13(12)15(20)23-14)9-18-16(21)22-8-10-4-2-1-3-5-10/h1-7,11-13H,8-9H2,(H,18,21)/t11?,12-,13+,17+/m0/s1 |
| InChIKey | AGRNUIBHUMCUPD-NCWJIKLMSA-N |
| XLogP | 0.94 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|