C21H22N2O7 — CID 155793776
4-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methoxycarbonylamino]butanoic acid (PubChem CID 155793776) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methoxycarbonylamino]butanoic acid.
| Compound Name | 4-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methoxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 155793776 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 4-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methoxycarbonylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)OCC12C=CC(O1)C1C(=O)N(Cc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C21H22N2O7/c24-15(25)7-4-10-22-20(28)29-12-21-9-8-14(30-21)16-17(21)19(27)23(18(16)26)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,14,16-17H,4,7,10-12H2,(H,22,28)(H,24,25) |
| InChIKey | BKPLYBHILSIXNA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|