C22H19N3O7S — CID 4253682
N-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methyl]-4-nitrobenzenesulfonamide (PubChem CID 4253682) has the molecular formula C22H19N3O7S and a molecular weight of 469.48 g/mol. Its IUPAC name is N-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4253682 |
| Molecular Formula | C22H19N3O7S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-[(2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl)methyl]-4-nitrobenzenesulfonamide |
| SMILES | O=C1C2C3C=CC(CNS(=O)(=O)c4ccc([N+](=O)[O-])cc4)(O3)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H19N3O7S/c26-20-18-17-10-11-22(32-17,19(18)21(27)24(20)12-14-4-2-1-3-5-14)13-23-33(30,31)16-8-6-15(7-9-16)25(28)29/h1-11,17-19,23H,12-13H2 |
| InChIKey | GQXMOYMENDCZKV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|