C24H20Cl2N2O5 — CID 99734293
N-[[(3aS,4S,7R,7aR)-2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 99734293) has the molecular formula C24H20Cl2N2O5 and a molecular weight of 487.34 g/mol. Its IUPAC name is N-[[(3aS,4S,7R,7aR)-2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[[(3aS,4S,7R,7aR)-2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 99734293 |
| Molecular Formula | C24H20Cl2N2O5 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[[(3aS,4S,7R,7aR)-2-benzyl-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC[C@@]12C=C[C@@H](O1)[C@@H]1C(=O)N(Cc3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H20Cl2N2O5/c25-15-6-7-17(16(26)10-15)32-12-19(29)27-13-24-9-8-18(33-24)20-21(24)23(31)28(22(20)30)11-14-4-2-1-3-5-14/h1-10,18,20-21H,11-13H2,(H,27,29)/t18-,20+,21-,24-/m1/s1 |
| InChIKey | FELFTSHHDGBNSM-LOCCHRAXSA-N |
| XLogP | 3.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|