C21H24ClN3O4 — CID 98419261
1-[[(3aS,4R,7R,7aS)-2-(3-chloro-4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-tert-butylurea (PubChem CID 98419261) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is 1-[[(3aS,4R,7R,7aS)-2-(3-chloro-4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-tert-butylurea.
| Compound Name | 1-[[(3aS,4R,7R,7aS)-2-(3-chloro-4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-tert-butylurea |
|---|---|
| PubChem CID | 98419261 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-[[(3aS,4R,7R,7aS)-2-(3-chloro-4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-tert-butylurea |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H]4C=C[C@@](CNC(=O)NC(C)(C)C)(O4)[C@H]3C2=O)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O4/c1-11-5-6-12(9-13(11)22)25-17(26)15-14-7-8-21(29-14,16(15)18(25)27)10-23-19(28)24-20(2,3)4/h5-9,14-16H,10H2,1-4H3,(H2,23,24,28)/t14-,15-,16-,21+/m1/s1 |
| InChIKey | VAMPMQGOGIZPGR-PFKNGNAYSA-N |
| XLogP | 2.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|