C17H12ClF3N2O4 — CID 129440460
N-[[(3aS,4R,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 129440460) has the molecular formula C17H12ClF3N2O4 and a molecular weight of 400.74 g/mol. Its IUPAC name is N-[[(3aS,4R,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(3aS,4R,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 129440460 |
| Molecular Formula | C17H12ClF3N2O4 |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[[(3aS,4R,7R,7aR)-2-(4-chlorophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1[C@H]2[C@H]3C=C[C@@](CNC(=O)C(F)(F)F)(O3)[C@H]2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O4/c18-8-1-3-9(4-2-8)23-13(24)11-10-5-6-16(27-10,12(11)14(23)25)7-22-15(26)17(19,20)21/h1-6,10-12H,7H2,(H,22,26)/t10-,11+,12-,16+/m1/s1 |
| InChIKey | SVFFYOQDMUXXSD-JBBSTSQOSA-N |
| XLogP | 1.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|