C23H20FN3O3S — CID 124771763
1-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-(4-fluorophenyl)thiourea (PubChem CID 124771763) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 124771763 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[[(3aS,4R,7R,7aR)-2-(4-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@H]4C=C[C@@](CNC(=S)Nc5ccc(F)cc5)(O4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C23H20FN3O3S/c1-13-2-8-16(9-3-13)27-20(28)18-17-10-11-23(30-17,19(18)21(27)29)12-25-22(31)26-15-6-4-14(24)5-7-15/h2-11,17-19H,12H2,1H3,(H2,25,26,31)/t17-,18+,19-,23+/m1/s1 |
| InChIKey | ACFCHHALVAZPES-KCESLBEFSA-N |
| XLogP | 2.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|