C18H22N4O2 — CID 100898999
N-[(1R,6R,7R)-8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl]-3-(1,2,4-triazol-1-yl)benzamide (PubChem CID 100898999) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(1R,6R,7R)-8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl]-3-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(1R,6R,7R)-8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl]-3-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 100898999 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[(1R,6R,7R)-8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl]-3-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CC1(C)[C@H](NC(=O)c2cccc(-n3cncn3)c2)[C@H]2CCCO[C@H]21 |
| InChI | InChI=1S/C18H22N4O2/c1-18(2)15(14-7-4-8-24-16(14)18)21-17(23)12-5-3-6-13(9-12)22-11-19-10-20-22/h3,5-6,9-11,14-16H,4,7-8H2,1-2H3,(H,21,23)/t14-,15-,16-/m1/s1 |
| InChIKey | APRJFGXOUIIFAA-BZUAXINKSA-N |
| XLogP | 2.20 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |