C15H18N4O3S — CID 100628732
N-[(1-methylsulfonylcyclobutyl)methyl]-3-(1,2,4-triazol-1-yl)benzamide (PubChem CID 100628732) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[(1-methylsulfonylcyclobutyl)methyl]-3-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(1-methylsulfonylcyclobutyl)methyl]-3-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 100628732 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[(1-methylsulfonylcyclobutyl)methyl]-3-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CS(=O)(=O)C1(CNC(=O)c2cccc(-n3cncn3)c2)CCC1 |
| InChI | InChI=1S/C15H18N4O3S/c1-23(21,22)15(6-3-7-15)9-17-14(20)12-4-2-5-13(8-12)19-11-16-10-18-19/h2,4-5,8,10-11H,3,6-7,9H2,1H3,(H,17,20) |
| InChIKey | KNZHKPHINFJITF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |