C20H17N3O2S — CID 10090107
12-benzyl-4,5-dimethoxy-13-thia-10,11,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene (PubChem CID 10090107) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 12-benzyl-4,5-dimethoxy-13-thia-10,11,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene.
| Compound Name | 12-benzyl-4,5-dimethoxy-13-thia-10,11,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene |
|---|---|
| PubChem CID | 10090107 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 12-benzyl-4,5-dimethoxy-13-thia-10,11,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene |
| SMILES | COc1cc2c(cc1OC)-c1nc3sc(Cc4ccccc4)nn3c1C2 |
| InChI | InChI=1S/C20H17N3O2S/c1-24-16-10-13-9-15-19(14(13)11-17(16)25-2)21-20-23(15)22-18(26-20)8-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | LRWLQSLNSUCVAW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |