C17H28N2O3S2 — CID 100901271
(3R)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]-1-propylsulfonylpiperidine-3-carboxamide (PubChem CID 100901271) has the molecular formula C17H28N2O3S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (3R)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]-1-propylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]-1-propylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100901271 |
| Molecular Formula | C17H28N2O3S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3R)-N-[(1S)-2-methyl-1-thiophen-2-ylpropyl]-1-propylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCS(=O)(=O)N1CCC[C@@H](C(=O)N[C@H](c2cccs2)C(C)C)C1 |
| InChI | InChI=1S/C17H28N2O3S2/c1-4-11-24(21,22)19-9-5-7-14(12-19)17(20)18-16(13(2)3)15-8-6-10-23-15/h6,8,10,13-14,16H,4-5,7,9,11-12H2,1-3H3,(H,18,20)/t14-,16+/m1/s1 |
| InChIKey | UMYDSPOLIAZMEA-ZBFHGGJFSA-N |
| XLogP | 3.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |