C21H29NO3Si — CID 10090632
methyl 1-[2-[benzyl(trimethylsilylmethyl)amino]-2-oxoethyl]cyclohexa-2,5-diene-1-carboxylate (PubChem CID 10090632) has the molecular formula C21H29NO3Si and a molecular weight of 371.55 g/mol. Its IUPAC name is methyl 1-[2-[benzyl(trimethylsilylmethyl)amino]-2-oxoethyl]cyclohexa-2,5-diene-1-carboxylate.
| Compound Name | methyl 1-[2-[benzyl(trimethylsilylmethyl)amino]-2-oxoethyl]cyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 10090632 |
| Molecular Formula | C21H29NO3Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | methyl 1-[2-[benzyl(trimethylsilylmethyl)amino]-2-oxoethyl]cyclohexa-2,5-diene-1-carboxylate |
| SMILES | COC(=O)C1(CC(=O)N(Cc2ccccc2)C[Si](C)(C)C)C=CCC=C1 |
| InChI | InChI=1S/C21H29NO3Si/c1-25-20(24)21(13-9-6-10-14-21)15-19(23)22(17-26(2,3)4)16-18-11-7-5-8-12-18/h5,7-14H,6,15-17H2,1-4H3 |
| InChIKey | NWQNJCVGEABDBD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|