C19H33NO3Si2 — CID 10714769
methyl (2R,3S)-4-oxo-4-[[(1R)-1-phenylethyl]amino]-2,3-bis(trimethylsilyl)butanoate (PubChem CID 10714769) has the molecular formula C19H33NO3Si2 and a molecular weight of 379.65 g/mol. Its IUPAC name is methyl (2R,3S)-4-oxo-4-[[(1R)-1-phenylethyl]amino]-2,3-bis(trimethylsilyl)butanoate.
| Compound Name | methyl (2R,3S)-4-oxo-4-[[(1R)-1-phenylethyl]amino]-2,3-bis(trimethylsilyl)butanoate |
|---|---|
| PubChem CID | 10714769 |
| Molecular Formula | C19H33NO3Si2 |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | methyl (2R,3S)-4-oxo-4-[[(1R)-1-phenylethyl]amino]-2,3-bis(trimethylsilyl)butanoate |
| SMILES | COC(=O)[C@H]([C@H](C(=O)N[C@H](C)c1ccccc1)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C19H33NO3Si2/c1-14(15-12-10-9-11-13-15)20-18(21)16(24(3,4)5)17(19(22)23-2)25(6,7)8/h9-14,16-17H,1-8H3,(H,20,21)/t14-,16-,17+/m1/s1 |
| InChIKey | GCUXDLLLZJBGHQ-OIISXLGYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|