C18H32N6O — CID 100906866
(4aS,8aR)-N-[(2S)-2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide (PubChem CID 100906866) has the molecular formula C18H32N6O and a molecular weight of 348.50 g/mol. Its IUPAC name is (4aS,8aR)-N-[(2S)-2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide.
| Compound Name | (4aS,8aR)-N-[(2S)-2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 100906866 |
| Molecular Formula | C18H32N6O |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (4aS,8aR)-N-[(2S)-2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide |
| SMILES | CN1CC[C@@H]2[C@@H](CCCN2C(=O)NC[C@H](c2cnn(C)c2)N(C)C)C1 |
| InChI | InChI=1S/C18H32N6O/c1-21(2)17(15-10-20-23(4)13-15)11-19-18(25)24-8-5-6-14-12-22(3)9-7-16(14)24/h10,13-14,16-17H,5-9,11-12H2,1-4H3,(H,19,25)/t14-,16+,17+/m0/s1 |
| InChIKey | UOMCGJIVLAUUOE-USXIJHARSA-N |
| XLogP | 1.15 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |