C19H29N5O3 — CID 100909596
methyl 1-[(3R)-1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrrolidin-3-yl]triazole-4-carboxylate (PubChem CID 100909596) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 1-[(3R)-1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrrolidin-3-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3R)-1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrrolidin-3-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 100909596 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | methyl 1-[(3R)-1-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl]pyrrolidin-3-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2CCN(CC(=O)N3CCC[C@@H]4CCCC[C@H]43)C2)nn1 |
| InChI | InChI=1S/C19H29N5O3/c1-27-19(26)16-12-24(21-20-16)15-8-10-22(11-15)13-18(25)23-9-4-6-14-5-2-3-7-17(14)23/h12,14-15,17H,2-11,13H2,1H3/t14-,15+,17+/m0/s1 |
| InChIKey | ROBGBFOHBLHABH-ZMSDIMECSA-N |
| XLogP | 1.49 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |