C14H23NO4S — CID 100909929
methyl (2S)-2-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]sulfanylpropanoate (PubChem CID 100909929) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is methyl (2S)-2-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl (2S)-2-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 100909929 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (2S)-2-[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)[C@H](C)SCC(=O)N1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C14H23NO4S/c1-10(14(17)18-2)20-9-13(16)15-7-8-19-12-6-4-3-5-11(12)15/h10-12H,3-9H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | PEVCWHVEWASSMG-QJPTWQEYSA-N |
| XLogP | 1.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |