C17H28N2O2S2 — CID 95573600
[2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 95573600) has the molecular formula C17H28N2O2S2 and a molecular weight of 356.56 g/mol. Its IUPAC name is [2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 95573600 |
| Molecular Formula | C17H28N2O2S2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [2-[(4aS,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | CC1CCN(C(=S)SCC(=O)N2CCO[C@@H]3CCCC[C@@H]32)CC1 |
| InChI | InChI=1S/C17H28N2O2S2/c1-13-6-8-18(9-7-13)17(22)23-12-16(20)19-10-11-21-15-5-3-2-4-14(15)19/h13-15H,2-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | VBXQAUVPFDPAKM-LSDHHAIUSA-N |
| XLogP | 2.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|