C9H16N2OS2 — CID 4008886
(2-amino-2-oxoethyl) 4-methylpiperidine-1-carbodithioate (PubChem CID 4008886) has the molecular formula C9H16N2OS2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-methylpiperidine-1-carbodithioate.
| Compound Name | (2-amino-2-oxoethyl) 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 4008886 |
| Molecular Formula | C9H16N2OS2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-methylpiperidine-1-carbodithioate |
| SMILES | CC1CCN(C(=S)SCC(N)=O)CC1 |
| InChI | InChI=1S/C9H16N2OS2/c1-7-2-4-11(5-3-7)9(13)14-6-8(10)12/h7H,2-6H2,1H3,(H2,10,12) |
| InChIKey | RYUQFIIDATVCQY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|