C10H16NO2S2- — CID 9484307
(2S)-2-(4-methylpiperidine-1-carbothioyl)sulfanylpropanoate (PubChem CID 9484307) has the molecular formula C10H16NO2S2- and a molecular weight of 246.38 g/mol. Its IUPAC name is (2S)-2-(4-methylpiperidine-1-carbothioyl)sulfanylpropanoate.
| Compound Name | (2S)-2-(4-methylpiperidine-1-carbothioyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 9484307 |
| Molecular Formula | C10H16NO2S2- |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (2S)-2-(4-methylpiperidine-1-carbothioyl)sulfanylpropanoate |
| SMILES | CC1CCN(C(=S)S[C@@H](C)C(=O)[O-])CC1 |
| InChI | InChI=1S/C10H17NO2S2/c1-7-3-5-11(6-4-7)10(14)15-8(2)9(12)13/h7-8H,3-6H2,1-2H3,(H,12,13)/p-1/t8-/m0/s1 |
| InChIKey | VFDDDYLWPSUPDT-QMMMGPOBSA-M |
| XLogP | 0.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|