C6H6N4OS — CID 100910819
6-amino-2-sulfanylidene-3,4-dihydro-1H-imidazo[4,5-b]pyridin-7-one (PubChem CID 100910819) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 6-amino-2-sulfanylidene-3,4-dihydro-1H-imidazo[4,5-b]pyridin-7-one.
| Compound Name | 6-amino-2-sulfanylidene-3,4-dihydro-1H-imidazo[4,5-b]pyridin-7-one |
|---|---|
| PubChem CID | 100910819 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 6-amino-2-sulfanylidene-3,4-dihydro-1H-imidazo[4,5-b]pyridin-7-one |
| SMILES | Nc1c[nH]c2[nH]c(=S)[nH]c2c1=O |
| InChI | InChI=1S/C6H6N4OS/c7-2-1-8-5-3(4(2)11)9-6(12)10-5/h1H,7H2,(H3,8,9,10,11,12) |
| InChIKey | FLAVWVVCDKQYNO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|