C8H14N2OS — CID 143328363
propane;1-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)ethanone (PubChem CID 143328363) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is propane;1-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)ethanone.
| Compound Name | propane;1-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)ethanone |
|---|---|
| PubChem CID | 143328363 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | propane;1-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)ethanone |
| SMILES | CC(=O)c1c[nH]c(=S)[nH]1.CCC |
| InChI | InChI=1S/C5H6N2OS.C3H8/c1-3(8)4-2-6-5(9)7-4;1-3-2/h2H,1H3,(H2,6,7,9);3H2,1-2H3 |
| InChIKey | QHNNEFIORZEPCW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|