C22H26N2O2S — CID 10091321
2-(3,3-diethoxypropylsulfanyl)-4,5-diphenyl-1H-imidazole (PubChem CID 10091321) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylsulfanyl)-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-(3,3-diethoxypropylsulfanyl)-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 10091321 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-(3,3-diethoxypropylsulfanyl)-4,5-diphenyl-1H-imidazole |
| SMILES | CCOC(CCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)OCC |
| InChI | InChI=1S/C22H26N2O2S/c1-3-25-19(26-4-2)15-16-27-22-23-20(17-11-7-5-8-12-17)21(24-22)18-13-9-6-10-14-18/h5-14,19H,3-4,15-16H2,1-2H3,(H,23,24) |
| InChIKey | DPSOBGLGMJUMOF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|