C15H18O5 — CID 100915074
methyl (1R,2R,7R,8S)-6,6-dimethoxy-5-oxotricyclo[6.2.1.02,7]undeca-3,9-diene-2-carboxylate (PubChem CID 100915074) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (1R,2R,7R,8S)-6,6-dimethoxy-5-oxotricyclo[6.2.1.02,7]undeca-3,9-diene-2-carboxylate.
| Compound Name | methyl (1R,2R,7R,8S)-6,6-dimethoxy-5-oxotricyclo[6.2.1.02,7]undeca-3,9-diene-2-carboxylate |
|---|---|
| PubChem CID | 100915074 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (1R,2R,7R,8S)-6,6-dimethoxy-5-oxotricyclo[6.2.1.02,7]undeca-3,9-diene-2-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)C(OC)(OC)[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H18O5/c1-18-13(17)14-7-6-11(16)15(19-2,20-3)12(14)9-4-5-10(14)8-9/h4-7,9-10,12H,8H2,1-3H3/t9-,10+,12-,14-/m1/s1 |
| InChIKey | AJOGOWGMEAANNP-IQOUGMIPSA-N |
| XLogP | 1.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|