C17H20O4 — CID 11897296
ethyl (1S,2R,7S,8S)-8,9,10-trimethyl-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-1-carboxylate (PubChem CID 11897296) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is ethyl (1S,2R,7S,8S)-8,9,10-trimethyl-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-1-carboxylate.
| Compound Name | ethyl (1S,2R,7S,8S)-8,9,10-trimethyl-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-1-carboxylate |
|---|---|
| PubChem CID | 11897296 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | ethyl (1S,2R,7S,8S)-8,9,10-trimethyl-3,6-dioxotricyclo[6.2.1.02,7]undeca-4,9-diene-1-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@](C)(C(C)=C1C)[C@H]1C(=O)C=CC(=O)[C@H]12 |
| InChI | InChI=1S/C17H20O4/c1-5-21-15(20)17-8-16(4,9(2)10(17)3)13-11(18)6-7-12(19)14(13)17/h6-7,13-14H,5,8H2,1-4H3/t13-,14+,16+,17+/m0/s1 |
| InChIKey | NISFYWWPFSVQDA-XOSAIJSUSA-N |
| XLogP | 2.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|