C21H28O5 — CID 162420036
dimethyl (1S,2R,3S,6S,7R)-3-(4-methylpent-3-enyl)-5-oxotricyclo[5.2.2.02,6]undec-8-ene-1,7-dicarboxylate (PubChem CID 162420036) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,6S,7R)-3-(4-methylpent-3-enyl)-5-oxotricyclo[5.2.2.02,6]undec-8-ene-1,7-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,6S,7R)-3-(4-methylpent-3-enyl)-5-oxotricyclo[5.2.2.02,6]undec-8-ene-1,7-dicarboxylate |
|---|---|
| PubChem CID | 162420036 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | dimethyl (1S,2R,3S,6S,7R)-3-(4-methylpent-3-enyl)-5-oxotricyclo[5.2.2.02,6]undec-8-ene-1,7-dicarboxylate |
| SMILES | COC(=O)[C@]12C=C[C@](C(=O)OC)(CC1)[C@H]1C(=O)C[C@H](CCC=C(C)C)[C@H]12 |
| InChI | InChI=1S/C21H28O5/c1-13(2)6-5-7-14-12-15(22)17-16(14)20(18(23)25-3)8-10-21(17,11-9-20)19(24)26-4/h6,8,10,14,16-17H,5,7,9,11-12H2,1-4H3/t14-,16+,17-,20+,21-/m0/s1 |
| InChIKey | IAXAKQAPTVQBEJ-QWJPLJMASA-N |
| XLogP | 3.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|