C14H20O4S — CID 100916295
6-hydroxy-5-(hydroxymethyl)-1-(4-methylphenyl)sulfinylhexan-2-one (PubChem CID 100916295) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is 6-hydroxy-5-(hydroxymethyl)-1-(4-methylphenyl)sulfinylhexan-2-one.
| Compound Name | 6-hydroxy-5-(hydroxymethyl)-1-(4-methylphenyl)sulfinylhexan-2-one |
|---|---|
| PubChem CID | 100916295 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-hydroxy-5-(hydroxymethyl)-1-(4-methylphenyl)sulfinylhexan-2-one |
| SMILES | Cc1ccc(S(=O)CC(=O)CCC(CO)CO)cc1 |
| InChI | InChI=1S/C14H20O4S/c1-11-2-6-14(7-3-11)19(18)10-13(17)5-4-12(8-15)9-16/h2-3,6-7,12,15-16H,4-5,8-10H2,1H3 |
| InChIKey | ZHUAXEGYRIBUDZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |