C46H52N2O4 — CID 100917217
[(2R,4S)-4-(dibenzylamino)-5-trityloxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 100917217) has the molecular formula C46H52N2O4 and a molecular weight of 696.93 g/mol. Its IUPAC name is [(2R,4S)-4-(dibenzylamino)-5-trityloxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(2R,4S)-4-(dibenzylamino)-5-trityloxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 100917217 |
| Molecular Formula | C46H52N2O4 |
| Molecular Weight | 696.93 g/mol |
| Exact Mass | 696.39 |
| IUPAC Name | [(2R,4S)-4-(dibenzylamino)-5-trityloxypentan-2-yl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H](C[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1)OC(=O)N1C(C)(C)COC1(C)C |
| InChI | InChI=1S/C46H52N2O4/c1-36(52-43(49)48-44(2,3)35-51-45(48,4)5)31-42(47(32-37-21-11-6-12-22-37)33-38-23-13-7-14-24-38)34-50-46(39-25-15-8-16-26-39,40-27-17-9-18-28-40)41-29-19-10-20-30-41/h6-30,36,42H,31-35H2,1-5H3/t36-,42+/m1/s1 |
| InChIKey | YGZRSSVNUPFHLW-WGYIJZORSA-N |
| XLogP | 9.83 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.93 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|