C53H77N3O3Sn — CID 134905626
[(1S,2S)-2,5-bis(dibenzylamino)-1-tributylstannylpentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 134905626) has the molecular formula C53H77N3O3Sn and a molecular weight of 922.93 g/mol. Its IUPAC name is [(1S,2S)-2,5-bis(dibenzylamino)-1-tributylstannylpentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1S,2S)-2,5-bis(dibenzylamino)-1-tributylstannylpentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134905626 |
| Molecular Formula | C53H77N3O3Sn |
| Molecular Weight | 922.93 g/mol |
| Exact Mass | 923.50 |
| IUPAC Name | [(1S,2S)-2,5-bis(dibenzylamino)-1-tributylstannylpentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H](OC(=O)N1C(C)(C)COC1(C)C)[C@H](CCCN(Cc1ccccc1)Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C41H50N3O3.3C4H9.Sn/c1-40(2)33-47-41(3,4)44(40)39(45)46-32-38(43(30-36-22-13-7-14-23-36)31-37-24-15-8-16-25-37)26-17-27-42(28-34-18-9-5-10-19-34)29-35-20-11-6-12-21-35;3*1-3-4-2;/h5-16,18-25,32,38H,17,26-31,33H2,1-4H3;3*1,3-4H2,2H3;/t38-;;;;/m0..../s1 |
| InChIKey | MZQUUMUIMBARDE-LZMOYPEXSA-N |
| XLogP | 13.28 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.93 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |