C32H40N6O — CID 100917591
1,4-bis[bis[(6-methyl-2-pyridinyl)methyl]amino]butan-2-ol (PubChem CID 100917591) has the molecular formula C32H40N6O and a molecular weight of 524.71 g/mol. Its IUPAC name is 1,4-bis[bis[(6-methyl-2-pyridinyl)methyl]amino]butan-2-ol.
| Compound Name | 1,4-bis[bis[(6-methyl-2-pyridinyl)methyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 100917591 |
| Molecular Formula | C32H40N6O |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 1,4-bis[bis[(6-methyl-2-pyridinyl)methyl]amino]butan-2-ol |
| SMILES | Cc1cccc(CN(CCC(O)CN(Cc2cccc(C)n2)Cc2cccc(C)n2)Cc2cccc(C)n2)n1 |
| InChI | InChI=1S/C32H40N6O/c1-24-9-5-13-28(33-24)19-37(20-29-14-6-10-25(2)34-29)18-17-32(39)23-38(21-30-15-7-11-26(3)35-30)22-31-16-8-12-27(4)36-31/h5-16,32,39H,17-23H2,1-4H3 |
| InChIKey | ZIZLHWDUYMPGFE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |