C14H30N2O2S2 — CID 100918982
1,5-bis(2-hydroxysulfanyl-2-methylpropyl)-1,5-diazocane (PubChem CID 100918982) has the molecular formula C14H30N2O2S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1,5-bis(2-hydroxysulfanyl-2-methylpropyl)-1,5-diazocane.
| Compound Name | 1,5-bis(2-hydroxysulfanyl-2-methylpropyl)-1,5-diazocane |
|---|---|
| PubChem CID | 100918982 |
| Molecular Formula | C14H30N2O2S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1,5-bis(2-hydroxysulfanyl-2-methylpropyl)-1,5-diazocane |
| SMILES | CC(C)(CN1CCCN(CC(C)(C)SO)CCC1)SO |
| InChI | InChI=1S/C14H30N2O2S2/c1-13(2,19-17)11-15-7-5-9-16(10-6-8-15)12-14(3,4)20-18/h17-18H,5-12H2,1-4H3 |
| InChIKey | VOEZORUWBQCMPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|