C11H16I2Si — CID 100919377
2,2-diethyl-1,3-diiodo-5,6-dihydro-4H-cyclopenta[c]silole (PubChem CID 100919377) has the molecular formula C11H16I2Si and a molecular weight of 430.14 g/mol. Its IUPAC name is 2,2-diethyl-1,3-diiodo-5,6-dihydro-4H-cyclopenta[c]silole.
| Compound Name | 2,2-diethyl-1,3-diiodo-5,6-dihydro-4H-cyclopenta[c]silole |
|---|---|
| PubChem CID | 100919377 |
| Molecular Formula | C11H16I2Si |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 429.91 |
| IUPAC Name | 2,2-diethyl-1,3-diiodo-5,6-dihydro-4H-cyclopenta[c]silole |
| SMILES | CC[Si]1(CC)C(I)=C2CCCC2=C1I |
| InChI | InChI=1S/C11H16I2Si/c1-3-14(4-2)10(12)8-6-5-7-9(8)11(14)13/h3-7H2,1-2H3 |
| InChIKey | JZHGOJLIUHLJDP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|